C20H26N2O2 — CID 167496453
(2R)-2-[1-(isoquinolin-8-ylmethylamino)ethenyl]-5,5-dimethylhexanoic acid (PubChem CID 167496453) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R)-2-[1-(isoquinolin-8-ylmethylamino)ethenyl]-5,5-dimethylhexanoic acid.
| Compound Name | (2R)-2-[1-(isoquinolin-8-ylmethylamino)ethenyl]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496453 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2R)-2-[1-(isoquinolin-8-ylmethylamino)ethenyl]-5,5-dimethylhexanoic acid |
| SMILES | C=C(NCc1cccc2ccncc12)[C@@H](CCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H26N2O2/c1-14(17(19(23)24)8-10-20(2,3)4)22-12-16-7-5-6-15-9-11-21-13-18(15)16/h5-7,9,11,13,17,22H,1,8,10,12H2,2-4H3,(H,23,24)/t17-/m1/s1 |
| InChIKey | DRIWICKVIVQAGF-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |