C17H25N3O2 — CID 175558811
5,5-dimethyl-2-[(1-methylindazol-4-yl)methylamino]hexanoic acid (PubChem CID 175558811) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(1-methylindazol-4-yl)methylamino]hexanoic acid.
| Compound Name | 5,5-dimethyl-2-[(1-methylindazol-4-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 175558811 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5,5-dimethyl-2-[(1-methylindazol-4-yl)methylamino]hexanoic acid |
| SMILES | Cn1ncc2c(CNC(CCC(C)(C)C)C(=O)O)cccc21 |
| InChI | InChI=1S/C17H25N3O2/c1-17(2,3)9-8-14(16(21)22)18-10-12-6-5-7-15-13(12)11-19-20(15)4/h5-7,11,14,18H,8-10H2,1-4H3,(H,21,22) |
| InChIKey | TXCMXEQYNPBJPR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |