C18H26N2O2 — CID 167496449
(2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid (PubChem CID 167496449) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid.
| Compound Name | (2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 167496449 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2S)-5,5-dimethyl-2-[(1-methylindol-4-yl)methylamino]hexanoic acid |
| SMILES | Cn1ccc2c(CN[C@@H](CCC(C)(C)C)C(=O)O)cccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-18(2,3)10-8-15(17(21)22)19-12-13-6-5-7-16-14(13)9-11-20(16)4/h5-7,9,11,15,19H,8,10,12H2,1-4H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | CQOVSYQPXXMKNX-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |