C16H25NO3 — CID 167496485
(2S)-2-[(2-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid (PubChem CID 167496485) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is (2S)-2-[(2-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid.
| Compound Name | (2S)-2-[(2-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 167496485 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (2S)-2-[(2-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid |
| SMILES | COc1ccccc1CN[C@@H](CCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C16H25NO3/c1-16(2,3)10-9-13(15(18)19)17-11-12-7-5-6-8-14(12)20-4/h5-8,13,17H,9-11H2,1-4H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | BFSYEZQHQQAXIV-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |