C22H22NO3P — CID 132557514
2-diphenylphosphanyl-2-[(2-methoxyphenyl)methylamino]acetic acid (PubChem CID 132557514) has the molecular formula C22H22NO3P and a molecular weight of 379.40 g/mol. Its IUPAC name is 2-diphenylphosphanyl-2-[(2-methoxyphenyl)methylamino]acetic acid.
| Compound Name | 2-diphenylphosphanyl-2-[(2-methoxyphenyl)methylamino]acetic acid |
|---|---|
| PubChem CID | 132557514 |
| Molecular Formula | C22H22NO3P |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-diphenylphosphanyl-2-[(2-methoxyphenyl)methylamino]acetic acid |
| SMILES | COc1ccccc1CNC(C(=O)O)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22NO3P/c1-26-20-15-9-8-10-17(20)16-23-21(22(24)25)27(18-11-4-2-5-12-18)19-13-6-3-7-14-19/h2-15,21,23H,16H2,1H3,(H,24,25) |
| InChIKey | WZWBIHFCWQVXBW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|