C19H28N2O2 — CID 171573417
(2S)-2-[(1-ethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid (PubChem CID 171573417) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S)-2-[(1-ethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid.
| Compound Name | (2S)-2-[(1-ethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 171573417 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (2S)-2-[(1-ethylindol-4-yl)methylamino]-5,5-dimethylhexanoic acid |
| SMILES | CCn1ccc2c(CN[C@@H](CCC(C)(C)C)C(=O)O)cccc21 |
| InChI | InChI=1S/C19H28N2O2/c1-5-21-12-10-15-14(7-6-8-17(15)21)13-20-16(18(22)23)9-11-19(2,3)4/h6-8,10,12,16,20H,5,9,11,13H2,1-4H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | KNUYLZSOOZQMPQ-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |