C18H24N2O2 — CID 175558784
5,5-dimethyl-2-(quinolin-2-ylmethylamino)hexanoic acid (PubChem CID 175558784) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 5,5-dimethyl-2-(quinolin-2-ylmethylamino)hexanoic acid.
| Compound Name | 5,5-dimethyl-2-(quinolin-2-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 175558784 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 5,5-dimethyl-2-(quinolin-2-ylmethylamino)hexanoic acid |
| SMILES | CC(C)(C)CCC(NCc1ccc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C18H24N2O2/c1-18(2,3)11-10-16(17(21)22)19-12-14-9-8-13-6-4-5-7-15(13)20-14/h4-9,16,19H,10-12H2,1-3H3,(H,21,22) |
| InChIKey | DMGUYPDFHNHWOY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |