C13H21N3O2 — CID 175558789
5,5-dimethyl-2-(pyrimidin-5-ylmethylamino)hexanoic acid (PubChem CID 175558789) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5,5-dimethyl-2-(pyrimidin-5-ylmethylamino)hexanoic acid.
| Compound Name | 5,5-dimethyl-2-(pyrimidin-5-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 175558789 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5,5-dimethyl-2-(pyrimidin-5-ylmethylamino)hexanoic acid |
| SMILES | CC(C)(C)CCC(NCc1cncnc1)C(=O)O |
| InChI | InChI=1S/C13H21N3O2/c1-13(2,3)5-4-11(12(17)18)16-8-10-6-14-9-15-7-10/h6-7,9,11,16H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | SANWOBPZEYTQJR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |