C19H30N2O2 — CID 174215764
5,5-dimethyl-2-[(3-pyrrolidin-1-ylphenyl)methylamino]hexanoic acid (PubChem CID 174215764) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 5,5-dimethyl-2-[(3-pyrrolidin-1-ylphenyl)methylamino]hexanoic acid.
| Compound Name | 5,5-dimethyl-2-[(3-pyrrolidin-1-ylphenyl)methylamino]hexanoic acid |
|---|---|
| PubChem CID | 174215764 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 5,5-dimethyl-2-[(3-pyrrolidin-1-ylphenyl)methylamino]hexanoic acid |
| SMILES | CC(C)(C)CCC(NCc1cccc(N2CCCC2)c1)C(=O)O |
| InChI | InChI=1S/C19H30N2O2/c1-19(2,3)10-9-17(18(22)23)20-14-15-7-6-8-16(13-15)21-11-4-5-12-21/h6-8,13,17,20H,4-5,9-12,14H2,1-3H3,(H,22,23) |
| InChIKey | MUZCXGFHHUQEBR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |