C18H20N2O — CID 91394219
N-[(3-pyrrolidin-1-ylphenyl)methyl]benzamide (PubChem CID 91394219) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[(3-pyrrolidin-1-ylphenyl)methyl]benzamide.
| Compound Name | N-[(3-pyrrolidin-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 91394219 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[(3-pyrrolidin-1-ylphenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(N2CCCC2)c1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c21-18(16-8-2-1-3-9-16)19-14-15-7-6-10-17(13-15)20-11-4-5-12-20/h1-3,6-10,13H,4-5,11-12,14H2,(H,19,21) |
| InChIKey | RXMWBRUDFZCLLW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |