C17H25NO3 — CID 170974031
(2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,5-dimethylhexanoic acid (PubChem CID 170974031) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,5-dimethylhexanoic acid.
| Compound Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 170974031 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (2S)-2-(2,3-dihydro-1-benzofuran-5-ylmethylamino)-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CC[C@H](NCc1ccc2c(c1)CCO2)C(=O)O |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)8-6-14(16(19)20)18-11-12-4-5-15-13(10-12)7-9-21-15/h4-5,10,14,18H,6-9,11H2,1-3H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | XDXWSOWLAKOJMS-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|