C19H32N2O5S — CID 174219512
5,5-dimethyl-2-(5,6,7,8-tetrahydroquinolin-3-ylmethylamino)hexanoic acid;methanesulfonic acid (PubChem CID 174219512) has the molecular formula C19H32N2O5S and a molecular weight of 400.54 g/mol. Its IUPAC name is 5,5-dimethyl-2-(5,6,7,8-tetrahydroquinolin-3-ylmethylamino)hexanoic acid;methanesulfonic acid.
| Compound Name | 5,5-dimethyl-2-(5,6,7,8-tetrahydroquinolin-3-ylmethylamino)hexanoic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 174219512 |
| Molecular Formula | C19H32N2O5S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 5,5-dimethyl-2-(5,6,7,8-tetrahydroquinolin-3-ylmethylamino)hexanoic acid;methanesulfonic acid |
| SMILES | CC(C)(C)CCC(NCc1cnc2c(c1)CCCC2)C(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C18H28N2O2.CH4O3S/c1-18(2,3)9-8-16(17(21)22)20-12-13-10-14-6-4-5-7-15(14)19-11-13;1-5(2,3)4/h10-11,16,20H,4-9,12H2,1-3H3,(H,21,22);1H3,(H,2,3,4) |
| InChIKey | XVIJMEJCQUECBQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|