C20H29F2NO2 — CID 174215791
2-[[2,2-difluoro-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]-5,5-dimethylhexanoic acid (PubChem CID 174215791) has the molecular formula C20H29F2NO2 and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[[2,2-difluoro-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]-5,5-dimethylhexanoic acid.
| Compound Name | 2-[[2,2-difluoro-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 174215791 |
| Molecular Formula | C20H29F2NO2 |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-[[2,2-difluoro-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]-5,5-dimethylhexanoic acid |
| SMILES | CC(C)(C)CCC(NC(c1ccc2c(c1)CCCC2)C(F)F)C(=O)O |
| InChI | InChI=1S/C20H29F2NO2/c1-20(2,3)11-10-16(19(24)25)23-17(18(21)22)15-9-8-13-6-4-5-7-14(13)12-15/h8-9,12,16-18,23H,4-7,10-11H2,1-3H3,(H,24,25) |
| InChIKey | QVUVYKIRYMPIPS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |