C16H20ClN — CID 103140904
8-(3-chloro-4,4-dimethylpentyl)isoquinoline (PubChem CID 103140904) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is 8-(3-chloro-4,4-dimethylpentyl)isoquinoline.
| Compound Name | 8-(3-chloro-4,4-dimethylpentyl)isoquinoline |
|---|---|
| PubChem CID | 103140904 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 8-(3-chloro-4,4-dimethylpentyl)isoquinoline |
| SMILES | CC(C)(C)C(Cl)CCc1cccc2ccncc12 |
| InChI | InChI=1S/C16H20ClN/c1-16(2,3)15(17)8-7-12-5-4-6-13-9-10-18-11-14(12)13/h4-6,9-11,15H,7-8H2,1-3H3 |
| InChIKey | AHAKMXAEALKHCJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|