C13H17Cl2F — CID 112654030
2-chloro-1-(3-chloro-4,4-dimethylpentyl)-3-fluorobenzene (PubChem CID 112654030) has the molecular formula C13H17Cl2F and a molecular weight of 263.18 g/mol. Its IUPAC name is 2-chloro-1-(3-chloro-4,4-dimethylpentyl)-3-fluorobenzene.
| Compound Name | 2-chloro-1-(3-chloro-4,4-dimethylpentyl)-3-fluorobenzene |
|---|---|
| PubChem CID | 112654030 |
| Molecular Formula | C13H17Cl2F |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2-chloro-1-(3-chloro-4,4-dimethylpentyl)-3-fluorobenzene |
| SMILES | CC(C)(C)C(Cl)CCc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H17Cl2F/c1-13(2,3)11(14)8-7-9-5-4-6-10(16)12(9)15/h4-6,11H,7-8H2,1-3H3 |
| InChIKey | QBDSUPSPUQSMHH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|