C14H20ClFO — CID 82812107
1-(3-chloro-4,4-dimethylpentyl)-2-fluoro-3-methoxybenzene (PubChem CID 82812107) has the molecular formula C14H20ClFO and a molecular weight of 258.76 g/mol. Its IUPAC name is 1-(3-chloro-4,4-dimethylpentyl)-2-fluoro-3-methoxybenzene.
| Compound Name | 1-(3-chloro-4,4-dimethylpentyl)-2-fluoro-3-methoxybenzene |
|---|---|
| PubChem CID | 82812107 |
| Molecular Formula | C14H20ClFO |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-(3-chloro-4,4-dimethylpentyl)-2-fluoro-3-methoxybenzene |
| SMILES | COc1cccc(CCC(Cl)C(C)(C)C)c1F |
| InChI | InChI=1S/C14H20ClFO/c1-14(2,3)12(15)9-8-10-6-5-7-11(17-4)13(10)16/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | JFJGAEPDONFFKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|