C12H16ClFO — CID 112654007
1-(2-chloro-3-fluorophenyl)hexan-3-ol (PubChem CID 112654007) has the molecular formula C12H16ClFO and a molecular weight of 230.71 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)hexan-3-ol.
| Compound Name | 1-(2-chloro-3-fluorophenyl)hexan-3-ol |
|---|---|
| PubChem CID | 112654007 |
| Molecular Formula | C12H16ClFO |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)hexan-3-ol |
| SMILES | CCCC(O)CCc1cccc(F)c1Cl |
| InChI | InChI=1S/C12H16ClFO/c1-2-4-10(15)8-7-9-5-3-6-11(14)12(9)13/h3,5-6,10,15H,2,4,7-8H2,1H3 |
| InChIKey | ZAVMPBSNDMYJBO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |