C14H20N2O5 — CID 67333483
(4S)-5-amino-4-[(2,4-dimethoxyphenyl)methylamino]-5-oxopentanoic acid (PubChem CID 67333483) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is (4S)-5-amino-4-[(2,4-dimethoxyphenyl)methylamino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-[(2,4-dimethoxyphenyl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67333483 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (4S)-5-amino-4-[(2,4-dimethoxyphenyl)methylamino]-5-oxopentanoic acid |
| SMILES | COc1ccc(CN[C@@H](CCC(=O)O)C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-20-10-4-3-9(12(7-10)21-2)8-16-11(14(15)19)5-6-13(17)18/h3-4,7,11,16H,5-6,8H2,1-2H3,(H2,15,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | NCUASEXBLYAULV-NSHDSACASA-N |
| XLogP | 0.51 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |