C12H15F3N2O — CID 67121979
2-(benzylamino)-5,5,5-trifluoropentanamide (PubChem CID 67121979) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(benzylamino)-5,5,5-trifluoropentanamide.
| Compound Name | 2-(benzylamino)-5,5,5-trifluoropentanamide |
|---|---|
| PubChem CID | 67121979 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(benzylamino)-5,5,5-trifluoropentanamide |
| SMILES | NC(=O)C(CCC(F)(F)F)NCc1ccccc1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)7-6-10(11(16)18)17-8-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H2,16,18) |
| InChIKey | QMQYCNVDERFZSK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |