C17H14F6N2O — CID 113268835
2-(benzylamino)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide (PubChem CID 113268835) has the molecular formula C17H14F6N2O and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-(benzylamino)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(benzylamino)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113268835 |
| Molecular Formula | C17H14F6N2O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(benzylamino)-2-[3,5-bis(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)C(NCc1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O/c18-16(19,20)12-6-11(7-13(8-12)17(21,22)23)14(15(24)26)25-9-10-4-2-1-3-5-10/h1-8,14,25H,9H2,(H2,24,26) |
| InChIKey | RONYHWFMVVKNKW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |