C15H14BrFN2O — CID 81436090
2-(benzylamino)-2-(4-bromo-3-fluorophenyl)acetamide (PubChem CID 81436090) has the molecular formula C15H14BrFN2O and a molecular weight of 337.19 g/mol. Its IUPAC name is 2-(benzylamino)-2-(4-bromo-3-fluorophenyl)acetamide.
| Compound Name | 2-(benzylamino)-2-(4-bromo-3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 81436090 |
| Molecular Formula | C15H14BrFN2O |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-(benzylamino)-2-(4-bromo-3-fluorophenyl)acetamide |
| SMILES | NC(=O)C(NCc1ccccc1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C15H14BrFN2O/c16-12-7-6-11(8-13(12)17)14(15(18)20)19-9-10-4-2-1-3-5-10/h1-8,14,19H,9H2,(H2,18,20) |
| InChIKey | FUPQRVXVPAUREG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |