2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid

C15H13F2NO2 — CID 60992267

IUPAC2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(NCc1ccccc1)c1ccc(F)c(F)c1
InChIInChI=1S/C15H13F2NO2/c16-12-7-6-11(8-13(12)17)14(15(19)20)18-9-10-4-2-1-3-5-10/h1-8,14,18H,9H2,(H,19,20)
InChIKeyXCRXXWSNIVLBMM-UHFFFAOYSA-N
MW277.27 g/mol
LogP2.88
Rot. Bonds5

About 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid

2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid (PubChem CID 60992267) has the molecular formula C15H13F2NO2 and a molecular weight of 277.27 g/mol. Its IUPAC name is 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid
PubChem CID60992267
Molecular FormulaC15H13F2NO2
Molecular Weight277.27 g/mol
Exact Mass277.09
IUPAC Name2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(NCc1ccccc1)c1ccc(F)c(F)c1
InChIInChI=1S/C15H13F2NO2/c16-12-7-6-11(8-13(12)17)14(15(19)20)18-9-10-4-2-1-3-5-10/h1-8,14,18H,9H2,(H,19,20)
InChIKeyXCRXXWSNIVLBMM-UHFFFAOYSA-N
XLogP2.88
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.27
LogP ≤ 52.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid?
The IUPAC name of 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid (CID 60992267) is 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid is O=C(O)C(NCc1ccccc1)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid?
The InChIKey is XCRXXWSNIVLBMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO2/c16-12-7-6-11(8-13(12)17)14(15(19)20)18-9-10-4-2-1-3-5-10/h1-8,14,18H,9H2,(H,19,20).
What are the key properties of 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid?
2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid has a molecular weight of 277.27 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzylamino)-2-(3,4-difluorophenyl)acetic acid is sourced from PubChem (CID 60992267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).