C12H13Cl2NO5S — CID 156517255
dimethyl (2S)-2-[(4,5-dichlorothiophene-2-carbonyl)amino]pentanedioate (PubChem CID 156517255) has the molecular formula C12H13Cl2NO5S and a molecular weight of 354.21 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4,5-dichlorothiophene-2-carbonyl)amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(4,5-dichlorothiophene-2-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 156517255 |
| Molecular Formula | C12H13Cl2NO5S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | dimethyl (2S)-2-[(4,5-dichlorothiophene-2-carbonyl)amino]pentanedioate |
| SMILES | COC(=O)CC[C@H](NC(=O)c1cc(Cl)c(Cl)s1)C(=O)OC |
| InChI | InChI=1S/C12H13Cl2NO5S/c1-19-9(16)4-3-7(12(18)20-2)15-11(17)8-5-6(13)10(14)21-8/h5,7H,3-4H2,1-2H3,(H,15,17)/t7-/m0/s1 |
| InChIKey | YSNHZWDITAPMDV-ZETCQYMHSA-N |
| XLogP | 2.28 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |