C14H18N2O5 — CID 162641099
dimethyl (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioate (PubChem CID 162641099) has the molecular formula C14H18N2O5 and a molecular weight of 298.33 g/mol. Its IUPAC name is dimethyl (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioate.
| Compound Name | dimethyl (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioate |
|---|---|
| PubChem CID | 162641099 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | dimethyl (2S)-2-[(4-amino-2,3,5,6-tetradeuteriobenzoyl)amino]pentanedioate |
| SMILES | [2H]c1c([2H])c(C(=O)N[C@@H](CCC(=O)OC)C(=O)OC)c([2H])c([2H])c1N |
| InChI | InChI=1S/C14H18N2O5/c1-20-12(17)8-7-11(14(19)21-2)16-13(18)9-3-5-10(15)6-4-9/h3-6,11H,7-8,15H2,1-2H3,(H,16,18)/t11-/m0/s1/i3D,4D,5D,6D |
| InChIKey | KTNFJPQFZZYFPU-BECXPWMJSA-N |
| XLogP | 0.49 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|