methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate

C15H22N2O3 — CID 20624112

IUPACmethyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate
SMILESCCCC(NC(=O)c1cc(C)c(N)c(C)c1)C(=O)OC
InChIInChI=1S/C15H22N2O3/c1-5-6-12(15(19)20-4)17-14(18)11-7-9(2)13(16)10(3)8-11/h7-8,12H,5-6,16H2,1-4H3,(H,17,18)
InChIKeyHCMOTLFVPLIEJA-UHFFFAOYSA-N
MW278.35 g/mol
LogP1.96
Rot. Bonds5

About methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate

methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate (PubChem CID 20624112) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate.

Molecular Properties

Compound Namemethyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate
PubChem CID20624112
Molecular FormulaC15H22N2O3
Molecular Weight278.35 g/mol
Exact Mass278.16
IUPAC Namemethyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate
SMILESCCCC(NC(=O)c1cc(C)c(N)c(C)c1)C(=O)OC
InChIInChI=1S/C15H22N2O3/c1-5-6-12(15(19)20-4)17-14(18)11-7-9(2)13(16)10(3)8-11/h7-8,12H,5-6,16H2,1-4H3,(H,17,18)
InChIKeyHCMOTLFVPLIEJA-UHFFFAOYSA-N
XLogP1.96
TPSA81.42 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 51.96
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate?
The IUPAC name of methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate (CID 20624112) is methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate.
What is the SMILES notation for methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate?
The canonical SMILES for methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate is CCCC(NC(=O)c1cc(C)c(N)c(C)c1)C(=O)OC.
What is the InChIKey of methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate?
The InChIKey is HCMOTLFVPLIEJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3/c1-5-6-12(15(19)20-4)17-14(18)11-7-9(2)13(16)10(3)8-11/h7-8,12H,5-6,16H2,1-4H3,(H,17,18).
What are the key properties of methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate?
methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate has a molecular weight of 278.35 g/mol, XLogP of 1.96, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4-amino-3,5-dimethylbenzoyl)amino]pentanoate is sourced from PubChem (CID 20624112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).