C16H24N2O3 — CID 90694166
methyl (2R)-2-[(4-amino-3,5-dimethylbenzoyl)amino]-3-methylpentanoate (PubChem CID 90694166) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl (2R)-2-[(4-amino-3,5-dimethylbenzoyl)amino]-3-methylpentanoate.
| Compound Name | methyl (2R)-2-[(4-amino-3,5-dimethylbenzoyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 90694166 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | methyl (2R)-2-[(4-amino-3,5-dimethylbenzoyl)amino]-3-methylpentanoate |
| SMILES | CCC(C)[C@@H](NC(=O)c1cc(C)c(N)c(C)c1)C(=O)OC |
| InChI | InChI=1S/C16H24N2O3/c1-6-9(2)14(16(20)21-5)18-15(19)12-7-10(3)13(17)11(4)8-12/h7-9,14H,6,17H2,1-5H3,(H,18,19)/t9?,14-/m1/s1 |
| InChIKey | RMRHDGARZDAXTQ-IWSPRGBSSA-N |
| XLogP | 2.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|