C16H17F6NO3 — CID 112791620
methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylpentanoate (PubChem CID 112791620) has the molecular formula C16H17F6NO3 and a molecular weight of 385.30 g/mol. Its IUPAC name is methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 112791620 |
| Molecular Formula | C16H17F6NO3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | methyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C16H17F6NO3/c1-4-8(2)12(14(25)26-3)23-13(24)9-5-10(15(17,18)19)7-11(6-9)16(20,21)22/h5-8,12H,4H2,1-3H3,(H,23,24) |
| InChIKey | VEQBZSYOSRJQAJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |