C21H25F6NO5 — CID 139123287
dimethyl 2-[(3R,4S)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]heptan-3-yl]propanedioate (PubChem CID 139123287) has the molecular formula C21H25F6NO5 and a molecular weight of 485.42 g/mol. Its IUPAC name is dimethyl 2-[(3R,4S)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]heptan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(3R,4S)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]heptan-3-yl]propanedioate |
|---|---|
| PubChem CID | 139123287 |
| Molecular Formula | C21H25F6NO5 |
| Molecular Weight | 485.42 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | dimethyl 2-[(3R,4S)-4-[[3,5-bis(trifluoromethyl)benzoyl]amino]heptan-3-yl]propanedioate |
| SMILES | CCC[C@H](NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H](CC)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C21H25F6NO5/c1-5-7-15(14(6-2)16(18(30)32-3)19(31)33-4)28-17(29)11-8-12(20(22,23)24)10-13(9-11)21(25,26)27/h8-10,14-16H,5-7H2,1-4H3,(H,28,29)/t14-,15-/m0/s1 |
| InChIKey | MWAHAOPGULNLFJ-GJZGRUSLSA-N |
| XLogP | 4.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|