C13H12F6N4O — CID 74080724
N-(3-azidobutan-2-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 74080724) has the molecular formula C13H12F6N4O and a molecular weight of 354.25 g/mol. Its IUPAC name is N-(3-azidobutan-2-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(3-azidobutan-2-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 74080724 |
| Molecular Formula | C13H12F6N4O |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(3-azidobutan-2-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(N=[N+]=[N-])C(C)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F6N4O/c1-6(7(2)22-23-20)21-11(24)8-3-9(12(14,15)16)5-10(4-8)13(17,18)19/h3-7H,1-2H3,(H,21,24) |
| InChIKey | NITYQUMEIGERSO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|