C25H23F6NOP+ — CID 162539902
[(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propyl]-methyl-diphenylphosphanium (PubChem CID 162539902) has the molecular formula C25H23F6NOP+ and a molecular weight of 498.43 g/mol. Its IUPAC name is [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propyl]-methyl-diphenylphosphanium.
| Compound Name | [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propyl]-methyl-diphenylphosphanium |
|---|---|
| PubChem CID | 162539902 |
| Molecular Formula | C25H23F6NOP+ |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [(2S)-2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propyl]-methyl-diphenylphosphanium |
| SMILES | C[C@@H](C[P+](C)(c1ccccc1)c1ccccc1)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F6NOP/c1-17(16-34(2,21-9-5-3-6-10-21)22-11-7-4-8-12-22)32-23(33)18-13-19(24(26,27)28)15-20(14-18)25(29,30)31/h3-15,17H,16H2,1-2H3/p+1/t17-/m0/s1 |
| InChIKey | LIFKZFZLMXPHJT-KRWDZBQOSA-O |
| XLogP | 6.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|