C27H27BrF6NOP — CID 164678424
N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 164678424) has the molecular formula C27H27BrF6NOP and a molecular weight of 606.39 g/mol. Its IUPAC name is N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164678424 |
| Molecular Formula | C27H27BrF6NOP |
| Molecular Weight | 606.39 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | N-[(2S)-1-(bromo-methyl-diphenyl-λ5-phosphanyl)-3-methylbutan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CC(C)[C@@H](CP(C)(Br)(c1ccccc1)c1ccccc1)NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27BrF6NOP/c1-18(2)24(17-37(3,28,22-10-6-4-7-11-22)23-12-8-5-9-13-23)35-25(36)19-14-20(26(29,30)31)16-21(15-19)27(32,33)34/h4-16,18,24H,17H2,1-3H3,(H,35,36)/t24-/m1/s1 |
| InChIKey | KJJPIOUNAVDXSU-XMMPIXPASA-N |
| XLogP | 7.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.39 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|