C37H30BrF6N2O3P — CID 164672626
N-[(2S)-1-[bromo-[(3-nitrophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-phenylpropan-2-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 164672626) has the molecular formula C37H30BrF6N2O3P and a molecular weight of 775.52 g/mol. Its IUPAC name is N-[(2S)-1-[bromo-[(3-nitrophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-phenylpropan-2-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-1-[bromo-[(3-nitrophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-phenylpropan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 164672626 |
| Molecular Formula | C37H30BrF6N2O3P |
| Molecular Weight | 775.52 g/mol |
| Exact Mass | 774.11 |
| IUPAC Name | N-[(2S)-1-[bromo-[(3-nitrophenyl)methyl]-diphenyl-λ5-phosphanyl]-3-phenylpropan-2-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@H](Cc1ccccc1)CP(Br)(Cc1cccc([N+](=O)[O-])c1)(c1ccccc1)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C37H30BrF6N2O3P/c38-50(33-15-6-2-7-16-33,34-17-8-3-9-18-34,24-27-13-10-14-32(20-27)46(48)49)25-31(19-26-11-4-1-5-12-26)45-35(47)28-21-29(36(39,40)41)23-30(22-28)37(42,43)44/h1-18,20-23,31H,19,24-25H2,(H,45,47)/t31-/m0/s1 |
| InChIKey | RNXLWKHYKKRRQL-HKBQPEDESA-N |
| XLogP | 9.69 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.52 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|