C18H12F7N3O5 — CID 3647708
N-(3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-yl)-3,5-dinitrobenzamide (PubChem CID 3647708) has the molecular formula C18H12F7N3O5 and a molecular weight of 483.30 g/mol. Its IUPAC name is N-(3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3647708 |
| Molecular Formula | C18H12F7N3O5 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-(3,3,4,4,5,5,5-heptafluoro-1-phenylpentan-2-yl)-3,5-dinitrobenzamide |
| SMILES | O=C(NC(Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)F)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H12F7N3O5/c19-16(20,17(21,22)18(23,24)25)14(6-10-4-2-1-3-5-10)26-15(29)11-7-12(27(30)31)9-13(8-11)28(32)33/h1-5,7-9,14H,6H2,(H,26,29) |
| InChIKey | GHSYJTYUSAFIMV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|