C14H12F9NO — CID 46944283
N-[(2S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-2-yl]acetamide (PubChem CID 46944283) has the molecular formula C14H12F9NO and a molecular weight of 381.24 g/mol. Its IUPAC name is N-[(2S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-2-yl]acetamide.
| Compound Name | N-[(2S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-2-yl]acetamide |
|---|---|
| PubChem CID | 46944283 |
| Molecular Formula | C14H12F9NO |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[(2S)-3,3,4,4,5,5,6,6,6-nonafluoro-1-phenylhexan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F9NO/c1-8(25)24-10(7-9-5-3-2-4-6-9)11(15,16)12(17,18)13(19,20)14(21,22)23/h2-6,10H,7H2,1H3,(H,24,25)/t10-/m0/s1 |
| InChIKey | DVBCUISHHGYOCQ-JTQLQIEISA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|