C15H14F9NO — CID 102171912
N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]acetamide (PubChem CID 102171912) has the molecular formula C15H14F9NO and a molecular weight of 395.27 g/mol. Its IUPAC name is N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]acetamide.
| Compound Name | N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]acetamide |
|---|---|
| PubChem CID | 102171912 |
| Molecular Formula | C15H14F9NO |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[(3R)-4,4,5,5,6,6,7,7,7-nonafluoro-1-phenylheptan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H](CCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H14F9NO/c1-9(26)25-11(8-7-10-5-3-2-4-6-10)12(16,17)13(18,19)14(20,21)15(22,23)24/h2-6,11H,7-8H2,1H3,(H,25,26)/t11-/m1/s1 |
| InChIKey | FZXXMHDTLAOIRG-LLVKDONJSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|