C18H23F3N2O2 — CID 75448366
1-acetyl-N-(1,1,1-trifluoro-4-phenylbutan-2-yl)piperidine-4-carboxamide (PubChem CID 75448366) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 1-acetyl-N-(1,1,1-trifluoro-4-phenylbutan-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(1,1,1-trifluoro-4-phenylbutan-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 75448366 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-acetyl-N-(1,1,1-trifluoro-4-phenylbutan-2-yl)piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NC(CCc2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-13(24)23-11-9-15(10-12-23)17(25)22-16(18(19,20)21)8-7-14-5-3-2-4-6-14/h2-6,15-16H,7-12H2,1H3,(H,22,25) |
| InChIKey | NNOGSFVCKSXPFP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |