C13H10F7NO3 — CID 11473902
(2S)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoic acid (PubChem CID 11473902) has the molecular formula C13H10F7NO3 and a molecular weight of 361.21 g/mol. Its IUPAC name is (2S)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11473902 |
| Molecular Formula | C13H10F7NO3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | (2S)-2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F7NO3/c14-11(15,12(16,17)13(18,19)20)10(24)21-8(9(22)23)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,21,24)(H,22,23)/t8-/m0/s1 |
| InChIKey | WQIUWPXBEHWYBX-QMMMGPOBSA-N |
| XLogP | 2.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|