C12H8F7N3O5 — CID 10525435
N-[(2R)-3,3,4,4,5,5,5-heptafluoropentan-2-yl]-3,5-dinitrobenzamide (PubChem CID 10525435) has the molecular formula C12H8F7N3O5 and a molecular weight of 407.20 g/mol. Its IUPAC name is N-[(2R)-3,3,4,4,5,5,5-heptafluoropentan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[(2R)-3,3,4,4,5,5,5-heptafluoropentan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 10525435 |
| Molecular Formula | C12H8F7N3O5 |
| Molecular Weight | 407.20 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[(2R)-3,3,4,4,5,5,5-heptafluoropentan-2-yl]-3,5-dinitrobenzamide |
| SMILES | C[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F7N3O5/c1-5(10(13,14)11(15,16)12(17,18)19)20-9(23)6-2-7(21(24)25)4-8(3-6)22(26)27/h2-5H,1H3,(H,20,23)/t5-/m1/s1 |
| InChIKey | AIGRBDMVZKGQHY-RXMQYKEDSA-N |
| XLogP | 3.45 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|