C13H16N4O6 — CID 14440643
3,5-dinitro-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide (PubChem CID 14440643) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 3,5-dinitro-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide.
| Compound Name | 3,5-dinitro-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 14440643 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3,5-dinitro-N-[(2S)-1-oxo-1-(propylamino)propan-2-yl]benzamide |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N4O6/c1-3-4-14-12(18)8(2)15-13(19)9-5-10(16(20)21)7-11(6-9)17(22)23/h5-8H,3-4H2,1-2H3,(H,14,18)(H,15,19)/t8-/m0/s1 |
| InChIKey | UESBHHVCXNBQRW-QMMMGPOBSA-N |
| XLogP | 1.15 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|