C19H24N6O10 — CID 101209605
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 101209605) has the molecular formula C19H24N6O10 and a molecular weight of 496.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101209605 |
| Molecular Formula | C19H24N6O10 |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[(3,5-dinitrobenzoyl)amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C19H24N6O10/c1-8(15(26)21-9(2)17(28)23-11(4)19(30)31)20-16(27)10(3)22-18(29)12-5-13(24(32)33)7-14(6-12)25(34)35/h5-11H,1-4H3,(H,20,27)(H,21,26)(H,22,29)(H,23,28)(H,30,31)/t8-,9-,10-,11-/m0/s1 |
| InChIKey | BCDLKEVHJLUMNI-NAKRPEOUSA-N |
| XLogP | -0.78 |
| TPSA | 239.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|