C12H14N4O7 — CID 122197720
N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]-3,5-dinitrobenzamide (PubChem CID 122197720) has the molecular formula C12H14N4O7 and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 122197720 |
| Molecular Formula | C12H14N4O7 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]-3,5-dinitrobenzamide |
| SMILES | CCNC(=O)C(CO)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H14N4O7/c1-2-13-12(19)10(6-17)14-11(18)7-3-8(15(20)21)5-9(4-7)16(22)23/h3-5,10,17H,2,6H2,1H3,(H,13,19)(H,14,18) |
| InChIKey | PNNHASHEGXTBQL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|