C30H37N5O8 — CID 132507547
1-N,3-N-bis[1-(butylamino)-3-hydroxy-1-oxopropan-2-yl]-5-[2-(4-nitrophenyl)ethynyl]benzene-1,3-dicarboxamide (PubChem CID 132507547) has the molecular formula C30H37N5O8 and a molecular weight of 595.65 g/mol. Its IUPAC name is 1-N,3-N-bis[1-(butylamino)-3-hydroxy-1-oxopropan-2-yl]-5-[2-(4-nitrophenyl)ethynyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[1-(butylamino)-3-hydroxy-1-oxopropan-2-yl]-5-[2-(4-nitrophenyl)ethynyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 132507547 |
| Molecular Formula | C30H37N5O8 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 1-N,3-N-bis[1-(butylamino)-3-hydroxy-1-oxopropan-2-yl]-5-[2-(4-nitrophenyl)ethynyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)C(CO)NC(=O)c1cc(C#Cc2ccc([N+](=O)[O-])cc2)cc(C(=O)NC(CO)C(=O)NCCCC)c1 |
| InChI | InChI=1S/C30H37N5O8/c1-3-5-13-31-29(40)25(18-36)33-27(38)22-15-21(8-7-20-9-11-24(12-10-20)35(42)43)16-23(17-22)28(39)34-26(19-37)30(41)32-14-6-4-2/h9-12,15-17,25-26,36-37H,3-6,13-14,18-19H2,1-2H3,(H,31,40)(H,32,41)(H,33,38)(H,34,39) |
| InChIKey | SJRPLHYCUFGNPN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 200.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|