C17H27N5O4 — CID 20768387
1-butyl-3-[(butylcarbamoylamino)-(4-nitrophenyl)methyl]urea (PubChem CID 20768387) has the molecular formula C17H27N5O4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-butyl-3-[(butylcarbamoylamino)-(4-nitrophenyl)methyl]urea.
| Compound Name | 1-butyl-3-[(butylcarbamoylamino)-(4-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 20768387 |
| Molecular Formula | C17H27N5O4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-butyl-3-[(butylcarbamoylamino)-(4-nitrophenyl)methyl]urea |
| SMILES | CCCCNC(=O)NC(NC(=O)NCCCC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H27N5O4/c1-3-5-11-18-16(23)20-15(21-17(24)19-12-6-4-2)13-7-9-14(10-8-13)22(25)26/h7-10,15H,3-6,11-12H2,1-2H3,(H2,18,20,23)(H2,19,21,24) |
| InChIKey | PJAIKFNBDFTGFM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|