C12H13N3O8 — CID 11759213
methyl (2R,3S)-2-[(3,5-dinitrobenzoyl)amino]-3-hydroxybutanoate (PubChem CID 11759213) has the molecular formula C12H13N3O8 and a molecular weight of 327.25 g/mol. Its IUPAC name is methyl (2R,3S)-2-[(3,5-dinitrobenzoyl)amino]-3-hydroxybutanoate.
| Compound Name | methyl (2R,3S)-2-[(3,5-dinitrobenzoyl)amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 11759213 |
| Molecular Formula | C12H13N3O8 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | methyl (2R,3S)-2-[(3,5-dinitrobenzoyl)amino]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)[C@H](C)O |
| InChI | InChI=1S/C12H13N3O8/c1-6(16)10(12(18)23-2)13-11(17)7-3-8(14(19)20)5-9(4-7)15(21)22/h3-6,10,16H,1-2H3,(H,13,17)/t6-,10+/m0/s1 |
| InChIKey | KLEYMKBMFQAQFJ-QUBYGPBYSA-N |
| XLogP | 0.16 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|