C12H13Cl2NO4 — CID 124571933
methyl (2S,3S)-2-[(3,5-dichlorobenzoyl)amino]-3-hydroxybutanoate (PubChem CID 124571933) has the molecular formula C12H13Cl2NO4 and a molecular weight of 306.15 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(3,5-dichlorobenzoyl)amino]-3-hydroxybutanoate.
| Compound Name | methyl (2S,3S)-2-[(3,5-dichlorobenzoyl)amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 124571933 |
| Molecular Formula | C12H13Cl2NO4 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | methyl (2S,3S)-2-[(3,5-dichlorobenzoyl)amino]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cc(Cl)cc(Cl)c1)[C@H](C)O |
| InChI | InChI=1S/C12H13Cl2NO4/c1-6(16)10(12(18)19-2)15-11(17)7-3-8(13)5-9(14)4-7/h3-6,10,16H,1-2H3,(H,15,17)/t6-,10-/m0/s1 |
| InChIKey | LNWCGRMABWODSQ-WKEGUHRASA-N |
| XLogP | 1.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |