C14H19NO6 — CID 85159268
methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate (PubChem CID 85159268) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate.
| Compound Name | methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 85159268 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate |
| SMILES | COC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(C)O |
| InChI | InChI=1S/C14H19NO6/c1-8(16)12(14(18)21-4)15-13(17)9-5-10(19-2)7-11(6-9)20-3/h5-8,12,16H,1-4H3,(H,15,17) |
| InChIKey | FKOWBJPFKRYECB-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |