methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate

C14H19NO6 — CID 85159268

IUPACmethyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate
SMILESCOC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(C)O
InChIInChI=1S/C14H19NO6/c1-8(16)12(14(18)21-4)15-13(17)9-5-10(19-2)7-11(6-9)20-3/h5-8,12,16H,1-4H3,(H,15,17)
InChIKeyFKOWBJPFKRYECB-UHFFFAOYSA-N
MW297.31 g/mol
LogP0.36
Rot. Bonds6

About methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate

methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate (PubChem CID 85159268) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate.

Molecular Properties

Compound Namemethyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate
PubChem CID85159268
Molecular FormulaC14H19NO6
Molecular Weight297.31 g/mol
Exact Mass297.12
IUPAC Namemethyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate
SMILESCOC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(C)O
InChIInChI=1S/C14H19NO6/c1-8(16)12(14(18)21-4)15-13(17)9-5-10(19-2)7-11(6-9)20-3/h5-8,12,16H,1-4H3,(H,15,17)
InChIKeyFKOWBJPFKRYECB-UHFFFAOYSA-N
XLogP0.36
TPSA94.09 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.31
LogP ≤ 50.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate?
The IUPAC name of methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate (CID 85159268) is methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate.
What is the SMILES notation for methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate?
The canonical SMILES for methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate is COC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(C)O.
What is the InChIKey of methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate?
The InChIKey is FKOWBJPFKRYECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO6/c1-8(16)12(14(18)21-4)15-13(17)9-5-10(19-2)7-11(6-9)20-3/h5-8,12,16H,1-4H3,(H,15,17).
What are the key properties of methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate?
methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate has a molecular weight of 297.31 g/mol, XLogP of 0.36, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(3,5-dimethoxybenzoyl)amino]-3-hydroxybutanoate is sourced from PubChem (CID 85159268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).