C16H21NO7 — CID 33240158
diethyl 2-[(3,5-dimethoxybenzoyl)amino]propanedioate (PubChem CID 33240158) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is diethyl 2-[(3,5-dimethoxybenzoyl)amino]propanedioate.
| Compound Name | diethyl 2-[(3,5-dimethoxybenzoyl)amino]propanedioate |
|---|---|
| PubChem CID | 33240158 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | diethyl 2-[(3,5-dimethoxybenzoyl)amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(=O)OCC |
| InChI | InChI=1S/C16H21NO7/c1-5-23-15(19)13(16(20)24-6-2)17-14(18)10-7-11(21-3)9-12(8-10)22-4/h7-9,13H,5-6H2,1-4H3,(H,17,18) |
| InChIKey | DLZJRQGNUHHAII-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|