C16H15F6NO5 — CID 33240327
diethyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propanedioate (PubChem CID 33240327) has the molecular formula C16H15F6NO5 and a molecular weight of 415.29 g/mol. Its IUPAC name is diethyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propanedioate.
| Compound Name | diethyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propanedioate |
|---|---|
| PubChem CID | 33240327 |
| Molecular Formula | C16H15F6NO5 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | diethyl 2-[[3,5-bis(trifluoromethyl)benzoyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)OCC |
| InChI | InChI=1S/C16H15F6NO5/c1-3-27-13(25)11(14(26)28-4-2)23-12(24)8-5-9(15(17,18)19)7-10(6-8)16(20,21)22/h5-7,11H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | JSPARJHLXPRQLA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|