C14H12F6N2O3 — CID 142705383
ethyl (2E)-2-[[3,5-bis(trifluoromethyl)benzoyl]hydrazinylidene]propanoate (PubChem CID 142705383) has the molecular formula C14H12F6N2O3 and a molecular weight of 370.25 g/mol. Its IUPAC name is ethyl (2E)-2-[[3,5-bis(trifluoromethyl)benzoyl]hydrazinylidene]propanoate.
| Compound Name | ethyl (2E)-2-[[3,5-bis(trifluoromethyl)benzoyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 142705383 |
| Molecular Formula | C14H12F6N2O3 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | ethyl (2E)-2-[[3,5-bis(trifluoromethyl)benzoyl]hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N/NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F6N2O3/c1-3-25-12(24)7(2)21-22-11(23)8-4-9(13(15,16)17)6-10(5-8)14(18,19)20/h4-6H,3H2,1-2H3,(H,22,23)/b21-7+ |
| InChIKey | XGWNDRXCHUBEHH-QPSGOUHRSA-N |
| XLogP | 3.39 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|