C13H10F6N2O4 — CID 3811461
ethyl 3-[3,5-bis(trifluoromethyl)anilino]-2-nitroprop-2-enoate (PubChem CID 3811461) has the molecular formula C13H10F6N2O4 and a molecular weight of 372.22 g/mol. Its IUPAC name is ethyl 3-[3,5-bis(trifluoromethyl)anilino]-2-nitroprop-2-enoate.
| Compound Name | ethyl 3-[3,5-bis(trifluoromethyl)anilino]-2-nitroprop-2-enoate |
|---|---|
| PubChem CID | 3811461 |
| Molecular Formula | C13H10F6N2O4 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | ethyl 3-[3,5-bis(trifluoromethyl)anilino]-2-nitroprop-2-enoate |
| SMILES | CCOC(=O)C(=CNc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H10F6N2O4/c1-2-25-11(22)10(21(23)24)6-20-9-4-7(12(14,15)16)3-8(5-9)13(17,18)19/h3-6,20H,2H2,1H3 |
| InChIKey | URLJQKLFHVTUFX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|